C8H7N3 — CID 54433684
3H-pyrido[2,3-b][1,4]diazepine (PubChem CID 54433684) has the molecular formula C8H7N3 and a molecular weight of 145.16 g/mol. Its IUPAC name is 3H-pyrido[2,3-b][1,4]diazepine.
| Compound Name | 3H-pyrido[2,3-b][1,4]diazepine |
|---|---|
| PubChem CID | 54433684 |
| Molecular Formula | C8H7N3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.06 |
| IUPAC Name | 3H-pyrido[2,3-b][1,4]diazepine |
| SMILES | C1=Nc2cccnc2N=CC1 |
| InChI | InChI=1S/C8H7N3/c1-3-7-8(10-4-1)11-6-2-5-9-7/h1,3-6H,2H2 |
| InChIKey | WJGLJJLHTXUTAL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |