About spiro[cyclobutane-1,3'-pyrrolo[3,2-b]pyridine]
spiro[cyclobutane-1,3'-pyrrolo[3,2-b]pyridine] (PubChem CID 175942833) has the molecular formula C10H10N2
and a molecular weight of 158.20 g/mol. Its IUPAC name is spiro[cyclobutane-1,3'-pyrrolo[3,2-b]pyridine].
Molecular Properties
| Compound Name | spiro[cyclobutane-1,3'-pyrrolo[3,2-b]pyridine] |
| PubChem CID | 175942833 |
| Molecular Formula | C10H10N2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | spiro[cyclobutane-1,3'-pyrrolo[3,2-b]pyridine] |
| SMILES | C1=Nc2cccnc2C12CCC2 |
| InChI | InChI=1S/C10H10N2/c1-3-8-9(11-6-1)10(7-12-8)4-2-5-10/h1,3,6-7H,2,4-5H2 |
| InChIKey | UWUGVDSLRUDGTJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[cyclobutane-1,3'-pyrrolo[3,2-b]pyridine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[cyclobutane-1,3'-pyrrolo[3,2-b]pyridine]?
The IUPAC name of spiro[cyclobutane-1,3'-pyrrolo[3,2-b]pyridine] (CID 175942833) is spiro[cyclobutane-1,3'-pyrrolo[3,2-b]pyridine].
What is the SMILES notation for spiro[cyclobutane-1,3'-pyrrolo[3,2-b]pyridine]?
The canonical SMILES for spiro[cyclobutane-1,3'-pyrrolo[3,2-b]pyridine] is C1=Nc2cccnc2C12CCC2.
What is the InChIKey of spiro[cyclobutane-1,3'-pyrrolo[3,2-b]pyridine]?
The InChIKey is UWUGVDSLRUDGTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2/c1-3-8-9(11-6-1)10(7-12-8)4-2-5-10/h1,3,6-7H,2,4-5H2.
What are the key properties of spiro[cyclobutane-1,3'-pyrrolo[3,2-b]pyridine]?
spiro[cyclobutane-1,3'-pyrrolo[3,2-b]pyridine] has a molecular weight of 158.20 g/mol, XLogP of 2.22, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[cyclobutane-1,3'-pyrrolo[3,2-b]pyridine] is sourced from PubChem (CID 175942833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).