C9H12N2O3 — CID 175042613
(2-ethoxy-3-pyridinyl)methyl carbamate (PubChem CID 175042613) has the molecular formula C9H12N2O3 and a molecular weight of 196.21 g/mol. Its IUPAC name is (2-ethoxy-3-pyridinyl)methyl carbamate.
| Compound Name | (2-ethoxy-3-pyridinyl)methyl carbamate |
|---|---|
| PubChem CID | 175042613 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | (2-ethoxy-3-pyridinyl)methyl carbamate |
| SMILES | CCOc1ncccc1COC(N)=O |
| InChI | InChI=1S/C9H12N2O3/c1-2-13-8-7(4-3-5-11-8)6-14-9(10)12/h3-5H,2,6H2,1H3,(H2,10,12) |
| InChIKey | LPOPKESAMDOPCX-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |