2-amino-3-(2-ethoxy-3-pyridinyl)propanoic acid

C10H14N2O3 — CID 170879502

IUPAC2-amino-3-(2-ethoxy-3-pyridinyl)propanoic acid
SMILESCCOc1ncccc1CC(N)C(=O)O
InChIInChI=1S/C10H14N2O3/c1-2-15-9-7(4-3-5-12-9)6-8(11)10(13)14/h3-5,8H,2,6,11H2,1H3,(H,13,14)
InChIKeyRNUZXEHMUPMDOG-UHFFFAOYSA-N
MW210.23 g/mol
LogP0.43
Rot. Bonds5

About 2-amino-3-(2-ethoxy-3-pyridinyl)propanoic acid

2-amino-3-(2-ethoxy-3-pyridinyl)propanoic acid (PubChem CID 170879502) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is 2-amino-3-(2-ethoxy-3-pyridinyl)propanoic acid.

Molecular Properties

Compound Name2-amino-3-(2-ethoxy-3-pyridinyl)propanoic acid
PubChem CID170879502
Molecular FormulaC10H14N2O3
Molecular Weight210.23 g/mol
Exact Mass210.10
IUPAC Name2-amino-3-(2-ethoxy-3-pyridinyl)propanoic acid
SMILESCCOc1ncccc1CC(N)C(=O)O
InChIInChI=1S/C10H14N2O3/c1-2-15-9-7(4-3-5-12-9)6-8(11)10(13)14/h3-5,8H,2,6,11H2,1H3,(H,13,14)
InChIKeyRNUZXEHMUPMDOG-UHFFFAOYSA-N
XLogP0.43
TPSA85.44 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.23
LogP ≤ 50.43
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-amino-3-(2-ethoxy-3-pyridinyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3-(2-ethoxy-3-pyridinyl)-2-methylpropanoic acid
CID 83884320
2-amino-3-(2-ethoxyphenyl)propanoic acid
CID 4241494
2-amino-3-(2-chloro-3-pyridinyl)propanoic acid
CID 22326364
1-(2-ethoxy-3-pyridinyl)propan-2-one
CID 83875082
2-amino-3-[2-(difluoromethyl)-3-pyridinyl]propanoic acid
CID 84681612
(2-ethoxy-3-pyridinyl)methyl carbamate
CID 175042613
2-amino-3-(3-ethoxy-2-hydroxyphenyl)propanoic acid
CID 62963313
2-amino-3-(2,3-diethoxyphenyl)propanoic acid
CID 170879597
(2R)-2-amino-3-(2-cyano-3-pyridinyl)propanoic acid
CID 127019845
ethyl 2-amino-3-(2-fluoro-3-pyridinyl)propanoate
CID 66518197
2-[(2-ethoxy-3-pyridinyl)amino]propanoic acid
CID 66173717
1-[(2-ethoxy-3-pyridinyl)methyl]-3-pentan-3-ylurea
CID 47160556

Frequently Asked Questions

What is the IUPAC name of 2-amino-3-(2-ethoxy-3-pyridinyl)propanoic acid?
The IUPAC name of 2-amino-3-(2-ethoxy-3-pyridinyl)propanoic acid (CID 170879502) is 2-amino-3-(2-ethoxy-3-pyridinyl)propanoic acid.
What is the SMILES notation for 2-amino-3-(2-ethoxy-3-pyridinyl)propanoic acid?
The canonical SMILES for 2-amino-3-(2-ethoxy-3-pyridinyl)propanoic acid is CCOc1ncccc1CC(N)C(=O)O.
What is the InChIKey of 2-amino-3-(2-ethoxy-3-pyridinyl)propanoic acid?
The InChIKey is RNUZXEHMUPMDOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O3/c1-2-15-9-7(4-3-5-12-9)6-8(11)10(13)14/h3-5,8H,2,6,11H2,1H3,(H,13,14).
What are the key properties of 2-amino-3-(2-ethoxy-3-pyridinyl)propanoic acid?
2-amino-3-(2-ethoxy-3-pyridinyl)propanoic acid has a molecular weight of 210.23 g/mol, XLogP of 0.43, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(2-ethoxy-3-pyridinyl)propanoic acid is sourced from PubChem (CID 170879502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).