C9H10F2N2O2 — CID 84681612
2-amino-3-[2-(difluoromethyl)-3-pyridinyl]propanoic acid (PubChem CID 84681612) has the molecular formula C9H10F2N2O2 and a molecular weight of 216.19 g/mol. Its IUPAC name is 2-amino-3-[2-(difluoromethyl)-3-pyridinyl]propanoic acid.
| Compound Name | 2-amino-3-[2-(difluoromethyl)-3-pyridinyl]propanoic acid |
|---|---|
| PubChem CID | 84681612 |
| Molecular Formula | C9H10F2N2O2 |
| Molecular Weight | 216.19 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 2-amino-3-[2-(difluoromethyl)-3-pyridinyl]propanoic acid |
| SMILES | NC(Cc1cccnc1C(F)F)C(=O)O |
| InChI | InChI=1S/C9H10F2N2O2/c10-8(11)7-5(2-1-3-13-7)4-6(12)9(14)15/h1-3,6,8H,4,12H2,(H,14,15) |
| InChIKey | VKNMLFXTILTGCO-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.19 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |