C12H14Cl2N2O3 — CID 154727412
2-amino-3-(8-hydroxyquinolin-5-yl)propanoic acid;dihydrochloride (PubChem CID 154727412) has the molecular formula C12H14Cl2N2O3 and a molecular weight of 305.16 g/mol. Its IUPAC name is 2-amino-3-(8-hydroxyquinolin-5-yl)propanoic acid;dihydrochloride.
| Compound Name | 2-amino-3-(8-hydroxyquinolin-5-yl)propanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 154727412 |
| Molecular Formula | C12H14Cl2N2O3 |
| Molecular Weight | 305.16 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 2-amino-3-(8-hydroxyquinolin-5-yl)propanoic acid;dihydrochloride |
| SMILES | Cl.Cl.NC(Cc1ccc(O)c2ncccc12)C(=O)O |
| InChI | InChI=1S/C12H12N2O3.2ClH/c13-9(12(16)17)6-7-3-4-10(15)11-8(7)2-1-5-14-11;;/h1-5,9,15H,6,13H2,(H,16,17);2*1H |
| InChIKey | SBPUWEPIAMQXCH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.16 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |