C10H10N2O3S — CID 23253802
2-amino-3-(4-hydroxy-1,3-benzothiazol-7-yl)propanoic acid (PubChem CID 23253802) has the molecular formula C10H10N2O3S and a molecular weight of 238.27 g/mol. Its IUPAC name is 2-amino-3-(4-hydroxy-1,3-benzothiazol-7-yl)propanoic acid.
| Compound Name | 2-amino-3-(4-hydroxy-1,3-benzothiazol-7-yl)propanoic acid |
|---|---|
| PubChem CID | 23253802 |
| Molecular Formula | C10H10N2O3S |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 2-amino-3-(4-hydroxy-1,3-benzothiazol-7-yl)propanoic acid |
| SMILES | NC(Cc1ccc(O)c2ncsc12)C(=O)O |
| InChI | InChI=1S/C10H10N2O3S/c11-6(10(14)15)3-5-1-2-7(13)8-9(5)16-4-12-8/h1-2,4,6,13H,3,11H2,(H,14,15) |
| InChIKey | VEGBCFKOYRFKNO-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |