C12H16N2O5S — CID 21123809
2-amino-3-[2-[(2S)-2-amino-3-sulfanylpropanoyl]-3,4-dihydroxyphenyl]propanoic acid (PubChem CID 21123809) has the molecular formula C12H16N2O5S and a molecular weight of 300.34 g/mol. Its IUPAC name is 2-amino-3-[2-[(2S)-2-amino-3-sulfanylpropanoyl]-3,4-dihydroxyphenyl]propanoic acid.
| Compound Name | 2-amino-3-[2-[(2S)-2-amino-3-sulfanylpropanoyl]-3,4-dihydroxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 21123809 |
| Molecular Formula | C12H16N2O5S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 2-amino-3-[2-[(2S)-2-amino-3-sulfanylpropanoyl]-3,4-dihydroxyphenyl]propanoic acid |
| SMILES | NC(Cc1ccc(O)c(O)c1C(=O)[C@H](N)CS)C(=O)O |
| InChI | InChI=1S/C12H16N2O5S/c13-6(12(18)19)3-5-1-2-8(15)11(17)9(5)10(16)7(14)4-20/h1-2,6-7,15,17,20H,3-4,13-14H2,(H,18,19)/t6?,7-/m1/s1 |
| InChIKey | JPVRATUSNHWYRR-COBSHVIPSA-N |
| XLogP | -0.51 |
| TPSA | 146.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|