C10H10ClNO4 — CID 135203756
(2S)-2-amino-3-(3-chloro-2-formyl-4-hydroxyphenyl)propanoic acid (PubChem CID 135203756) has the molecular formula C10H10ClNO4 and a molecular weight of 243.65 g/mol. Its IUPAC name is (2S)-2-amino-3-(3-chloro-2-formyl-4-hydroxyphenyl)propanoic acid.
| Compound Name | (2S)-2-amino-3-(3-chloro-2-formyl-4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 135203756 |
| Molecular Formula | C10H10ClNO4 |
| Molecular Weight | 243.65 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | (2S)-2-amino-3-(3-chloro-2-formyl-4-hydroxyphenyl)propanoic acid |
| SMILES | N[C@@H](Cc1ccc(O)c(Cl)c1C=O)C(=O)O |
| InChI | InChI=1S/C10H10ClNO4/c11-9-6(4-13)5(1-2-8(9)14)3-7(12)10(15)16/h1-2,4,7,14H,3,12H2,(H,15,16)/t7-/m0/s1 |
| InChIKey | MUSZNCCXNXSSRN-ZETCQYMHSA-N |
| XLogP | 0.81 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.65 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|