C10H10N2O3 — CID 84778964
2-amino-3-furo[2,3-b]pyridin-3-ylpropanoic acid (PubChem CID 84778964) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is 2-amino-3-furo[2,3-b]pyridin-3-ylpropanoic acid.
| Compound Name | 2-amino-3-furo[2,3-b]pyridin-3-ylpropanoic acid |
|---|---|
| PubChem CID | 84778964 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 2-amino-3-furo[2,3-b]pyridin-3-ylpropanoic acid |
| SMILES | NC(Cc1coc2ncccc12)C(=O)O |
| InChI | InChI=1S/C10H10N2O3/c11-8(10(13)14)4-6-5-15-9-7(6)2-1-3-12-9/h1-3,5,8H,4,11H2,(H,13,14) |
| InChIKey | BCCJTOHVZXPNRU-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |