2-amino-3-furo[2,3-b]pyridin-3-ylpropanoic acid

C10H10N2O3 — CID 84778964

IUPAC2-amino-3-furo[2,3-b]pyridin-3-ylpropanoic acid
SMILESNC(Cc1coc2ncccc12)C(=O)O
InChIInChI=1S/C10H10N2O3/c11-8(10(13)14)4-6-5-15-9-7(6)2-1-3-12-9/h1-3,5,8H,4,11H2,(H,13,14)
InChIKeyBCCJTOHVZXPNRU-UHFFFAOYSA-N
MW206.20 g/mol
LogP0.78
Rot. Bonds3

About 2-amino-3-furo[2,3-b]pyridin-3-ylpropanoic acid

2-amino-3-furo[2,3-b]pyridin-3-ylpropanoic acid (PubChem CID 84778964) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is 2-amino-3-furo[2,3-b]pyridin-3-ylpropanoic acid.

Molecular Properties

Compound Name2-amino-3-furo[2,3-b]pyridin-3-ylpropanoic acid
PubChem CID84778964
Molecular FormulaC10H10N2O3
Molecular Weight206.20 g/mol
Exact Mass206.07
IUPAC Name2-amino-3-furo[2,3-b]pyridin-3-ylpropanoic acid
SMILESNC(Cc1coc2ncccc12)C(=O)O
InChIInChI=1S/C10H10N2O3/c11-8(10(13)14)4-6-5-15-9-7(6)2-1-3-12-9/h1-3,5,8H,4,11H2,(H,13,14)
InChIKeyBCCJTOHVZXPNRU-UHFFFAOYSA-N
XLogP0.78
TPSA89.35 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.20
LogP ≤ 50.78
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-amino-3-furo[2,3-b]pyridin-3-ylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-3-furo[2,3-b]pyridin-3-ylpropanoic acid?
The IUPAC name of 2-amino-3-furo[2,3-b]pyridin-3-ylpropanoic acid (CID 84778964) is 2-amino-3-furo[2,3-b]pyridin-3-ylpropanoic acid.
What is the SMILES notation for 2-amino-3-furo[2,3-b]pyridin-3-ylpropanoic acid?
The canonical SMILES for 2-amino-3-furo[2,3-b]pyridin-3-ylpropanoic acid is NC(Cc1coc2ncccc12)C(=O)O.
What is the InChIKey of 2-amino-3-furo[2,3-b]pyridin-3-ylpropanoic acid?
The InChIKey is BCCJTOHVZXPNRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O3/c11-8(10(13)14)4-6-5-15-9-7(6)2-1-3-12-9/h1-3,5,8H,4,11H2,(H,13,14).
What are the key properties of 2-amino-3-furo[2,3-b]pyridin-3-ylpropanoic acid?
2-amino-3-furo[2,3-b]pyridin-3-ylpropanoic acid has a molecular weight of 206.20 g/mol, XLogP of 0.78, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-furo[2,3-b]pyridin-3-ylpropanoic acid is sourced from PubChem (CID 84778964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).