C11H15NO3 — CID 4241494
2-amino-3-(2-ethoxyphenyl)propanoic acid (PubChem CID 4241494) has the molecular formula C11H15NO3 and a molecular weight of 209.25 g/mol. Its IUPAC name is 2-amino-3-(2-ethoxyphenyl)propanoic acid.
| Compound Name | 2-amino-3-(2-ethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 4241494 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 2-amino-3-(2-ethoxyphenyl)propanoic acid |
| SMILES | CCOc1ccccc1CC(N)C(=O)O |
| InChI | InChI=1S/C11H15NO3/c1-2-15-10-6-4-3-5-8(10)7-9(12)11(13)14/h3-6,9H,2,7,12H2,1H3,(H,13,14) |
| InChIKey | BAXARNMSRZWGGW-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |