C8H9N3O — CID 140922627
2,3-dihydro-1H-pyrrolo[3,2-b]pyridine-2-carboxamide (PubChem CID 140922627) has the molecular formula C8H9N3O and a molecular weight of 163.18 g/mol. Its IUPAC name is 2,3-dihydro-1H-pyrrolo[3,2-b]pyridine-2-carboxamide.
| Compound Name | 2,3-dihydro-1H-pyrrolo[3,2-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 140922627 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 2,3-dihydro-1H-pyrrolo[3,2-b]pyridine-2-carboxamide |
| SMILES | NC(=O)C1Cc2ncccc2N1 |
| InChI | InChI=1S/C8H9N3O/c9-8(12)7-4-6-5(11-7)2-1-3-10-6/h1-3,7,11H,4H2,(H2,9,12) |
| InChIKey | BMAGZYFBJPBYLV-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |