C15H20N4O2 — CID 107355898
1-(1,2,3,4-tetrahydroquinoxaline-2-carbonyl)piperidine-4-carboxamide (PubChem CID 107355898) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 1-(1,2,3,4-tetrahydroquinoxaline-2-carbonyl)piperidine-4-carboxamide.
| Compound Name | 1-(1,2,3,4-tetrahydroquinoxaline-2-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 107355898 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 1-(1,2,3,4-tetrahydroquinoxaline-2-carbonyl)piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=O)C2CNc3ccccc3N2)CC1 |
| InChI | InChI=1S/C15H20N4O2/c16-14(20)10-5-7-19(8-6-10)15(21)13-9-17-11-3-1-2-4-12(11)18-13/h1-4,10,13,17-18H,5-9H2,(H2,16,20) |
| InChIKey | QMTJNQRJGYOFMJ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'} |
|---|