C16H19N3O3 — CID 110694627
1-[2-(2-oxo-1,3-dihydroindol-3-yl)acetyl]piperidine-4-carboxamide (PubChem CID 110694627) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is 1-[2-(2-oxo-1,3-dihydroindol-3-yl)acetyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-(2-oxo-1,3-dihydroindol-3-yl)acetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 110694627 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 1-[2-(2-oxo-1,3-dihydroindol-3-yl)acetyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=O)CC2C(=O)Nc3ccccc32)CC1 |
| InChI | InChI=1S/C16H19N3O3/c17-15(21)10-5-7-19(8-6-10)14(20)9-12-11-3-1-2-4-13(11)18-16(12)22/h1-4,10,12H,5-9H2,(H2,17,21)(H,18,22) |
| InChIKey | DVPXDASHYXZPNB-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |