C16H20N2O2 — CID 110694649
3-[2-(3-methylpiperidin-1-yl)-2-oxoethyl]-1,3-dihydroindol-2-one (PubChem CID 110694649) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 3-[2-(3-methylpiperidin-1-yl)-2-oxoethyl]-1,3-dihydroindol-2-one.
| Compound Name | 3-[2-(3-methylpiperidin-1-yl)-2-oxoethyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 110694649 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 3-[2-(3-methylpiperidin-1-yl)-2-oxoethyl]-1,3-dihydroindol-2-one |
| SMILES | CC1CCCN(C(=O)CC2C(=O)Nc3ccccc32)C1 |
| InChI | InChI=1S/C16H20N2O2/c1-11-5-4-8-18(10-11)15(19)9-13-12-6-2-3-7-14(12)17-16(13)20/h2-3,6-7,11,13H,4-5,8-10H2,1H3,(H,17,20) |
| InChIKey | OYHAZYMFXBAKMW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |