C14H18N4O2 — CID 107356256
1-methyl-4-(1,2,3,4-tetrahydroquinoxaline-2-carbonyl)piperazin-2-one (PubChem CID 107356256) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 1-methyl-4-(1,2,3,4-tetrahydroquinoxaline-2-carbonyl)piperazin-2-one.
| Compound Name | 1-methyl-4-(1,2,3,4-tetrahydroquinoxaline-2-carbonyl)piperazin-2-one |
|---|---|
| PubChem CID | 107356256 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 1-methyl-4-(1,2,3,4-tetrahydroquinoxaline-2-carbonyl)piperazin-2-one |
| SMILES | CN1CCN(C(=O)C2CNc3ccccc3N2)CC1=O |
| InChI | InChI=1S/C14H18N4O2/c1-17-6-7-18(9-13(17)19)14(20)12-8-15-10-4-2-3-5-11(10)16-12/h2-5,12,15-16H,6-9H2,1H3 |
| InChIKey | RMZWNQORDPYFSF-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'} |
|---|