C15H19N3O2 — CID 102889006
4-(2,3-dihydro-1H-indole-2-carbonyl)-1-methyl-1,4-diazepan-2-one (PubChem CID 102889006) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 4-(2,3-dihydro-1H-indole-2-carbonyl)-1-methyl-1,4-diazepan-2-one.
| Compound Name | 4-(2,3-dihydro-1H-indole-2-carbonyl)-1-methyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 102889006 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 4-(2,3-dihydro-1H-indole-2-carbonyl)-1-methyl-1,4-diazepan-2-one |
| SMILES | CN1CCCN(C(=O)C2Cc3ccccc3N2)CC1=O |
| InChI | InChI=1S/C15H19N3O2/c1-17-7-4-8-18(10-14(17)19)15(20)13-9-11-5-2-3-6-12(11)16-13/h2-3,5-6,13,16H,4,7-10H2,1H3 |
| InChIKey | YCLBWBAHJDORKD-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |