C14H18N2O2 — CID 55153900
[(2S)-2,3-dihydro-1H-indol-2-yl]-(1,4-oxazepan-4-yl)methanone (PubChem CID 55153900) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is [(2S)-2,3-dihydro-1H-indol-2-yl]-(1,4-oxazepan-4-yl)methanone.
| Compound Name | [(2S)-2,3-dihydro-1H-indol-2-yl]-(1,4-oxazepan-4-yl)methanone |
|---|---|
| PubChem CID | 55153900 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | [(2S)-2,3-dihydro-1H-indol-2-yl]-(1,4-oxazepan-4-yl)methanone |
| SMILES | O=C([C@@H]1Cc2ccccc2N1)N1CCCOCC1 |
| InChI | InChI=1S/C14H18N2O2/c17-14(16-6-3-8-18-9-7-16)13-10-11-4-1-2-5-12(11)15-13/h1-2,4-5,13,15H,3,6-10H2/t13-/m0/s1 |
| InChIKey | UAMUWOKSLLPTLJ-ZDUSSCGKSA-N |
| XLogP | 1.27 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |