C18H24N2O — CID 76986786
8-azaspiro[4.5]decan-8-yl(2,3-dihydro-1H-indol-2-yl)methanone (PubChem CID 76986786) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is 8-azaspiro[4.5]decan-8-yl(2,3-dihydro-1H-indol-2-yl)methanone.
| Compound Name | 8-azaspiro[4.5]decan-8-yl(2,3-dihydro-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 76986786 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 8-azaspiro[4.5]decan-8-yl(2,3-dihydro-1H-indol-2-yl)methanone |
| SMILES | O=C(C1Cc2ccccc2N1)N1CCC2(CCCC2)CC1 |
| InChI | InChI=1S/C18H24N2O/c21-17(16-13-14-5-1-2-6-15(14)19-16)20-11-9-18(10-12-20)7-3-4-8-18/h1-2,5-6,16,19H,3-4,7-13H2 |
| InChIKey | BAXDAEVRCVBUJK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |