C16H23N3O — CID 107356172
(2,3-dimethylpiperidin-1-yl)-(1,2,3,4-tetrahydroquinoxalin-2-yl)methanone (PubChem CID 107356172) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is (2,3-dimethylpiperidin-1-yl)-(1,2,3,4-tetrahydroquinoxalin-2-yl)methanone.
| Compound Name | (2,3-dimethylpiperidin-1-yl)-(1,2,3,4-tetrahydroquinoxalin-2-yl)methanone |
|---|---|
| PubChem CID | 107356172 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | (2,3-dimethylpiperidin-1-yl)-(1,2,3,4-tetrahydroquinoxalin-2-yl)methanone |
| SMILES | CC1CCCN(C(=O)C2CNc3ccccc3N2)C1C |
| InChI | InChI=1S/C16H23N3O/c1-11-6-5-9-19(12(11)2)16(20)15-10-17-13-7-3-4-8-14(13)18-15/h3-4,7-8,11-12,15,17-18H,5-6,9-10H2,1-2H3 |
| InChIKey | PSXKTKUHQDHZKF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'} |
|---|