C9H9N3O2 — CID 141006823
2-oxo-3,4-dihydro-1H-1,5-naphthyridine-3-carboxamide (PubChem CID 141006823) has the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. Its IUPAC name is 2-oxo-3,4-dihydro-1H-1,5-naphthyridine-3-carboxamide.
| Compound Name | 2-oxo-3,4-dihydro-1H-1,5-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 141006823 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 2-oxo-3,4-dihydro-1H-1,5-naphthyridine-3-carboxamide |
| SMILES | NC(=O)C1Cc2ncccc2NC1=O |
| InChI | InChI=1S/C9H9N3O2/c10-8(13)5-4-7-6(12-9(5)14)2-1-3-11-7/h1-3,5H,4H2,(H2,10,13)(H,12,14) |
| InChIKey | NRJKWAILJNPKNU-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|