C8H8N2O — CID 84649209
6-amino-6,7-dihydrocyclopenta[b]pyridin-5-one (PubChem CID 84649209) has the molecular formula C8H8N2O and a molecular weight of 148.16 g/mol. Its IUPAC name is 6-amino-6,7-dihydrocyclopenta[b]pyridin-5-one.
| Compound Name | 6-amino-6,7-dihydrocyclopenta[b]pyridin-5-one |
|---|---|
| PubChem CID | 84649209 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 6-amino-6,7-dihydrocyclopenta[b]pyridin-5-one |
| SMILES | NC1Cc2ncccc2C1=O |
| InChI | InChI=1S/C8H8N2O/c9-6-4-7-5(8(6)11)2-1-3-10-7/h1-3,6H,4,9H2 |
| InChIKey | VEPKTMIYSQNHTO-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |