About 7,7-dimethyl-8H-pyrano[4,3-b]pyridin-5-one
7,7-dimethyl-8H-pyrano[4,3-b]pyridin-5-one (PubChem CID 175781475) has the molecular formula C10H11NO2
and a molecular weight of 177.20 g/mol. Its IUPAC name is 7,7-dimethyl-8H-pyrano[4,3-b]pyridin-5-one.
Molecular Properties
| Compound Name | 7,7-dimethyl-8H-pyrano[4,3-b]pyridin-5-one |
| PubChem CID | 175781475 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 7,7-dimethyl-8H-pyrano[4,3-b]pyridin-5-one |
| SMILES | CC1(C)Cc2ncccc2C(=O)O1 |
| InChI | InChI=1S/C10H11NO2/c1-10(2)6-8-7(9(12)13-10)4-3-5-11-8/h3-5H,6H2,1-2H3 |
| InChIKey | BEVKRZWBARKWJY-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7,7-dimethyl-8H-pyrano[4,3-b]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7-dimethyl-8H-pyrano[4,3-b]pyridin-5-one?
The IUPAC name of 7,7-dimethyl-8H-pyrano[4,3-b]pyridin-5-one (CID 175781475) is 7,7-dimethyl-8H-pyrano[4,3-b]pyridin-5-one.
What is the SMILES notation for 7,7-dimethyl-8H-pyrano[4,3-b]pyridin-5-one?
The canonical SMILES for 7,7-dimethyl-8H-pyrano[4,3-b]pyridin-5-one is CC1(C)Cc2ncccc2C(=O)O1.
What is the InChIKey of 7,7-dimethyl-8H-pyrano[4,3-b]pyridin-5-one?
The InChIKey is BEVKRZWBARKWJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2/c1-10(2)6-8-7(9(12)13-10)4-3-5-11-8/h3-5H,6H2,1-2H3.
What are the key properties of 7,7-dimethyl-8H-pyrano[4,3-b]pyridin-5-one?
7,7-dimethyl-8H-pyrano[4,3-b]pyridin-5-one has a molecular weight of 177.20 g/mol, XLogP of 1.57, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7-dimethyl-8H-pyrano[4,3-b]pyridin-5-one is sourced from PubChem (CID 175781475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).