About 11,12-dihydro-[1]benzoxocino[4,3-b]pyridin-5-one
11,12-dihydro-[1]benzoxocino[4,3-b]pyridin-5-one (PubChem CID 165346789) has the molecular formula C14H11NO2
and a molecular weight of 225.25 g/mol. Its IUPAC name is 11,12-dihydro-[1]benzoxocino[4,3-b]pyridin-5-one.
Molecular Properties
| Compound Name | 11,12-dihydro-[1]benzoxocino[4,3-b]pyridin-5-one |
| PubChem CID | 165346789 |
| Molecular Formula | C14H11NO2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 11,12-dihydro-[1]benzoxocino[4,3-b]pyridin-5-one |
| SMILES | O=C1Oc2ccccc2CCc2ncccc21 |
| InChI | InChI=1S/C14H11NO2/c16-14-11-5-3-9-15-12(11)8-7-10-4-1-2-6-13(10)17-14/h1-6,9H,7-8H2 |
| InChIKey | BYFWBPJVTDIZSR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 11,12-dihydro-[1]benzoxocino[4,3-b]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11,12-dihydro-[1]benzoxocino[4,3-b]pyridin-5-one?
The IUPAC name of 11,12-dihydro-[1]benzoxocino[4,3-b]pyridin-5-one (CID 165346789) is 11,12-dihydro-[1]benzoxocino[4,3-b]pyridin-5-one.
What is the SMILES notation for 11,12-dihydro-[1]benzoxocino[4,3-b]pyridin-5-one?
The canonical SMILES for 11,12-dihydro-[1]benzoxocino[4,3-b]pyridin-5-one is O=C1Oc2ccccc2CCc2ncccc21.
What is the InChIKey of 11,12-dihydro-[1]benzoxocino[4,3-b]pyridin-5-one?
The InChIKey is BYFWBPJVTDIZSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO2/c16-14-11-5-3-9-15-12(11)8-7-10-4-1-2-6-13(10)17-14/h1-6,9H,7-8H2.
What are the key properties of 11,12-dihydro-[1]benzoxocino[4,3-b]pyridin-5-one?
11,12-dihydro-[1]benzoxocino[4,3-b]pyridin-5-one has a molecular weight of 225.25 g/mol, XLogP of 2.40, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 11,12-dihydro-[1]benzoxocino[4,3-b]pyridin-5-one is sourced from PubChem (CID 165346789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).