About 12-azabicyclo[9.4.0]pentadeca-1(11),12,14-triene
12-azabicyclo[9.4.0]pentadeca-1(11),12,14-triene (PubChem CID 175984451) has the molecular formula C14H21N
and a molecular weight of 203.33 g/mol. Its IUPAC name is 12-azabicyclo[9.4.0]pentadeca-1(11),12,14-triene.
Molecular Properties
| Compound Name | 12-azabicyclo[9.4.0]pentadeca-1(11),12,14-triene |
| PubChem CID | 175984451 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 12-azabicyclo[9.4.0]pentadeca-1(11),12,14-triene |
| SMILES | c1cnc2c(c1)CCCCCCCCC2 |
| InChI | InChI=1S/C14H21N/c1-2-4-6-9-13-10-8-12-15-14(13)11-7-5-3-1/h8,10,12H,1-7,9,11H2 |
| InChIKey | RSZIVYXISCSSJX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 12-azabicyclo[9.4.0]pentadeca-1(11),12,14-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-azabicyclo[9.4.0]pentadeca-1(11),12,14-triene?
The IUPAC name of 12-azabicyclo[9.4.0]pentadeca-1(11),12,14-triene (CID 175984451) is 12-azabicyclo[9.4.0]pentadeca-1(11),12,14-triene.
What is the SMILES notation for 12-azabicyclo[9.4.0]pentadeca-1(11),12,14-triene?
The canonical SMILES for 12-azabicyclo[9.4.0]pentadeca-1(11),12,14-triene is c1cnc2c(c1)CCCCCCCCC2.
What is the InChIKey of 12-azabicyclo[9.4.0]pentadeca-1(11),12,14-triene?
The InChIKey is RSZIVYXISCSSJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N/c1-2-4-6-9-13-10-8-12-15-14(13)11-7-5-3-1/h8,10,12H,1-7,9,11H2.
What are the key properties of 12-azabicyclo[9.4.0]pentadeca-1(11),12,14-triene?
12-azabicyclo[9.4.0]pentadeca-1(11),12,14-triene has a molecular weight of 203.33 g/mol, XLogP of 3.91, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 12-azabicyclo[9.4.0]pentadeca-1(11),12,14-triene is sourced from PubChem (CID 175984451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).