C14H21N — CID 175984451
12-azabicyclo[9.4.0]pentadeca-1(11),12,14-triene (PubChem CID 175984451) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 12-azabicyclo[9.4.0]pentadeca-1(11),12,14-triene.
| Compound Name | 12-azabicyclo[9.4.0]pentadeca-1(11),12,14-triene |
|---|---|
| PubChem CID | 175984451 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 12-azabicyclo[9.4.0]pentadeca-1(11),12,14-triene |
| SMILES | c1cnc2c(c1)CCCCCCCCC2 |
| InChI | InChI=1S/C14H21N/c1-2-4-6-9-13-10-8-12-15-14(13)11-7-5-3-1/h8,10,12H,1-7,9,11H2 |
| InChIKey | RSZIVYXISCSSJX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |