C9H10N2 — CID 123589066
7,8-dihydro-5H-quinolin-6-imine (PubChem CID 123589066) has the molecular formula C9H10N2 and a molecular weight of 146.19 g/mol. Its IUPAC name is 7,8-dihydro-5H-quinolin-6-imine.
| Compound Name | 7,8-dihydro-5H-quinolin-6-imine |
|---|---|
| PubChem CID | 123589066 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 7,8-dihydro-5H-quinolin-6-imine |
| SMILES | [H]/N=C1\CCc2ncccc2C1 |
| InChI | InChI=1S/C9H10N2/c10-8-3-4-9-7(6-8)2-1-5-11-9/h1-2,5,10H,3-4,6H2/b10-8+ |
| InChIKey | LYWXHCCKXYCQCT-CSKARUKUSA-N |
| XLogP | 1.59 |
| TPSA | 36.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|