C16H19ClN2 — CID 165410301
16-chloro-5-azatricyclo[10.4.0.04,9]hexadeca-1(12),4(9),5,7,13,15-hexaene;methanamine (PubChem CID 165410301) has the molecular formula C16H19ClN2 and a molecular weight of 274.80 g/mol. Its IUPAC name is 16-chloro-5-azatricyclo[10.4.0.04,9]hexadeca-1(12),4(9),5,7,13,15-hexaene;methanamine.
| Compound Name | 16-chloro-5-azatricyclo[10.4.0.04,9]hexadeca-1(12),4(9),5,7,13,15-hexaene;methanamine |
|---|---|
| PubChem CID | 165410301 |
| Molecular Formula | C16H19ClN2 |
| Molecular Weight | 274.80 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 16-chloro-5-azatricyclo[10.4.0.04,9]hexadeca-1(12),4(9),5,7,13,15-hexaene;methanamine |
| SMILES | CN.Clc1cccc2c1CCc1ncccc1CC2 |
| InChI | InChI=1S/C15H14ClN.CH5N/c16-14-5-1-3-11-6-7-12-4-2-10-17-15(12)9-8-13(11)14;1-2/h1-5,10H,6-9H2;2H2,1H3 |
| InChIKey | ACCCJWKMVCLJIQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.80 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |