C19H23NO8 — CID 163858481
bis(but-2-enedioic acid);5,6,7,8,9,10-hexahydrocycloocta[b]pyridine (PubChem CID 163858481) has the molecular formula C19H23NO8 and a molecular weight of 393.39 g/mol. Its IUPAC name is bis(but-2-enedioic acid);5,6,7,8,9,10-hexahydrocycloocta[b]pyridine.
| Compound Name | bis(but-2-enedioic acid);5,6,7,8,9,10-hexahydrocycloocta[b]pyridine |
|---|---|
| PubChem CID | 163858481 |
| Molecular Formula | C19H23NO8 |
| Molecular Weight | 393.39 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | bis(but-2-enedioic acid);5,6,7,8,9,10-hexahydrocycloocta[b]pyridine |
| SMILES | O=C(O)C=CC(=O)O.O=C(O)C=CC(=O)O.c1cnc2c(c1)CCCCCC2 |
| InChI | InChI=1S/C11H15N.2C4H4O4/c1-2-4-8-11-10(6-3-1)7-5-9-12-11;2*5-3(6)1-2-4(7)8/h5,7,9H,1-4,6,8H2;2*1-2H,(H,5,6)(H,7,8) |
| InChIKey | PALNNCNGZBHAOA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 162.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.39 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|