5,6,7,8-tetrahydropyrido[2,3-b]azepine-9-carboxylic acid

C10H12N2O2 — CID 154512709

IUPAC5,6,7,8-tetrahydropyrido[2,3-b]azepine-9-carboxylic acid
SMILESO=C(O)N1CCCCc2cccnc21
InChIInChI=1S/C10H12N2O2/c13-10(14)12-7-2-1-4-8-5-3-6-11-9(8)12/h3,5-6H,1-2,4,7H2,(H,13,14)
InChIKeyQTVZZGQRKVKJPU-UHFFFAOYSA-N
MW192.22 g/mol
LogP1.90
Rot. Bonds

About 5,6,7,8-tetrahydropyrido[2,3-b]azepine-9-carboxylic acid

5,6,7,8-tetrahydropyrido[2,3-b]azepine-9-carboxylic acid (PubChem CID 154512709) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 5,6,7,8-tetrahydropyrido[2,3-b]azepine-9-carboxylic acid.

Molecular Properties

Compound Name5,6,7,8-tetrahydropyrido[2,3-b]azepine-9-carboxylic acid
PubChem CID154512709
Molecular FormulaC10H12N2O2
Molecular Weight192.22 g/mol
Exact Mass192.09
IUPAC Name5,6,7,8-tetrahydropyrido[2,3-b]azepine-9-carboxylic acid
SMILESO=C(O)N1CCCCc2cccnc21
InChIInChI=1S/C10H12N2O2/c13-10(14)12-7-2-1-4-8-5-3-6-11-9(8)12/h3,5-6H,1-2,4,7H2,(H,13,14)
InChIKeyQTVZZGQRKVKJPU-UHFFFAOYSA-N
XLogP1.90
TPSA53.43 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.22
LogP ≤ 51.90
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 5,6,7,8-tetrahydropyrido[2,3-b]azepine-9-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,6,7,8-tetrahydropyrido[2,3-b]azepine-9-carboxylic acid?
The IUPAC name of 5,6,7,8-tetrahydropyrido[2,3-b]azepine-9-carboxylic acid (CID 154512709) is 5,6,7,8-tetrahydropyrido[2,3-b]azepine-9-carboxylic acid.
What is the SMILES notation for 5,6,7,8-tetrahydropyrido[2,3-b]azepine-9-carboxylic acid?
The canonical SMILES for 5,6,7,8-tetrahydropyrido[2,3-b]azepine-9-carboxylic acid is O=C(O)N1CCCCc2cccnc21.
What is the InChIKey of 5,6,7,8-tetrahydropyrido[2,3-b]azepine-9-carboxylic acid?
The InChIKey is QTVZZGQRKVKJPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2/c13-10(14)12-7-2-1-4-8-5-3-6-11-9(8)12/h3,5-6H,1-2,4,7H2,(H,13,14).
What are the key properties of 5,6,7,8-tetrahydropyrido[2,3-b]azepine-9-carboxylic acid?
5,6,7,8-tetrahydropyrido[2,3-b]azepine-9-carboxylic acid has a molecular weight of 192.22 g/mol, XLogP of 1.90, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6,7,8-tetrahydropyrido[2,3-b]azepine-9-carboxylic acid is sourced from PubChem (CID 154512709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).