C13H24N2 — CID 91237685
ethane;1-methyl-3,4-dihydro-2H-1,8-naphthyridine (PubChem CID 91237685) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is ethane;1-methyl-3,4-dihydro-2H-1,8-naphthyridine.
| Compound Name | ethane;1-methyl-3,4-dihydro-2H-1,8-naphthyridine |
|---|---|
| PubChem CID | 91237685 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | ethane;1-methyl-3,4-dihydro-2H-1,8-naphthyridine |
| SMILES | CC.CC.CN1CCCc2cccnc21 |
| InChI | InChI=1S/C9H12N2.2C2H6/c1-11-7-3-5-8-4-2-6-10-9(8)11;2*1-2/h2,4,6H,3,5,7H2,1H3;2*1-2H3 |
| InChIKey | UENXCMMUURICTO-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |