About 1,6-dimethyl-3,4-dihydro-2H-1,8-naphthyridine;ethane
1,6-dimethyl-3,4-dihydro-2H-1,8-naphthyridine;ethane (PubChem CID 172631854) has the molecular formula C14H26N2
and a molecular weight of 222.38 g/mol. Its IUPAC name is 1,6-dimethyl-3,4-dihydro-2H-1,8-naphthyridine;ethane.
Molecular Properties
| Compound Name | 1,6-dimethyl-3,4-dihydro-2H-1,8-naphthyridine;ethane |
| PubChem CID | 172631854 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | 1,6-dimethyl-3,4-dihydro-2H-1,8-naphthyridine;ethane |
| SMILES | CC.CC.Cc1cnc2c(c1)CCCN2C |
| InChI | InChI=1S/C10H14N2.2C2H6/c1-8-6-9-4-3-5-12(2)10(9)11-7-8;2*1-2/h6-7H,3-5H2,1-2H3;2*1-2H3 |
| InChIKey | UOWSIRLIBQXNLT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,6-dimethyl-3,4-dihydro-2H-1,8-naphthyridine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dimethyl-3,4-dihydro-2H-1,8-naphthyridine;ethane?
The IUPAC name of 1,6-dimethyl-3,4-dihydro-2H-1,8-naphthyridine;ethane (CID 172631854) is 1,6-dimethyl-3,4-dihydro-2H-1,8-naphthyridine;ethane.
What is the SMILES notation for 1,6-dimethyl-3,4-dihydro-2H-1,8-naphthyridine;ethane?
The canonical SMILES for 1,6-dimethyl-3,4-dihydro-2H-1,8-naphthyridine;ethane is CC.CC.Cc1cnc2c(c1)CCCN2C.
What is the InChIKey of 1,6-dimethyl-3,4-dihydro-2H-1,8-naphthyridine;ethane?
The InChIKey is UOWSIRLIBQXNLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2.2C2H6/c1-8-6-9-4-3-5-12(2)10(9)11-7-8;2*1-2/h6-7H,3-5H2,1-2H3;2*1-2H3.
What are the key properties of 1,6-dimethyl-3,4-dihydro-2H-1,8-naphthyridine;ethane?
1,6-dimethyl-3,4-dihydro-2H-1,8-naphthyridine;ethane has a molecular weight of 222.38 g/mol, XLogP of 3.82, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dimethyl-3,4-dihydro-2H-1,8-naphthyridine;ethane is sourced from PubChem (CID 172631854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).