About ethane;6-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridine
ethane;6-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridine (PubChem CID 144996832) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is ethane;6-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridine.
Molecular Properties
| Compound Name | ethane;6-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridine |
| PubChem CID | 144996832 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | ethane;6-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridine |
| SMILES | CC.Cc1cnc2c(c1)CCCO2 |
| InChI | InChI=1S/C9H11NO.C2H6/c1-7-5-8-3-2-4-11-9(8)10-6-7;1-2/h5-6H,2-4H2,1H3;1-2H3 |
| InChIKey | LEDUJWHKWRIPNY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;6-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridine?
The IUPAC name of ethane;6-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridine (CID 144996832) is ethane;6-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridine.
What is the SMILES notation for ethane;6-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridine?
The canonical SMILES for ethane;6-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridine is CC.Cc1cnc2c(c1)CCCO2.
What is the InChIKey of ethane;6-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridine?
The InChIKey is LEDUJWHKWRIPNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO.C2H6/c1-7-5-8-3-2-4-11-9(8)10-6-7;1-2/h5-6H,2-4H2,1H3;1-2H3.
What are the key properties of ethane;6-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridine?
ethane;6-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridine has a molecular weight of 179.26 g/mol, XLogP of 2.74, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-methyl-3,4-dihydro-2H-pyrano[2,3-b]pyridine is sourced from PubChem (CID 144996832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).