C10H11IO — CID 59113741
8-iodo-6-methyl-3,4-dihydro-2H-chromene (PubChem CID 59113741) has the molecular formula C10H11IO and a molecular weight of 274.10 g/mol. Its IUPAC name is 8-iodo-6-methyl-3,4-dihydro-2H-chromene.
| Compound Name | 8-iodo-6-methyl-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 59113741 |
| Molecular Formula | C10H11IO |
| Molecular Weight | 274.10 g/mol |
| Exact Mass | 273.99 |
| IUPAC Name | 8-iodo-6-methyl-3,4-dihydro-2H-chromene |
| SMILES | Cc1cc(I)c2c(c1)CCCO2 |
| InChI | InChI=1S/C10H11IO/c1-7-5-8-3-2-4-12-10(8)9(11)6-7/h5-6H,2-4H2,1H3 |
| InChIKey | WFLQOCMDBAVRGU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.10 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|