C15H28N2 — CID 156820229
ethane;1,5,7-trimethyl-3,4-dihydro-2H-1,8-naphthyridine (PubChem CID 156820229) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is ethane;1,5,7-trimethyl-3,4-dihydro-2H-1,8-naphthyridine.
| Compound Name | ethane;1,5,7-trimethyl-3,4-dihydro-2H-1,8-naphthyridine |
|---|---|
| PubChem CID | 156820229 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | ethane;1,5,7-trimethyl-3,4-dihydro-2H-1,8-naphthyridine |
| SMILES | CC.CC.Cc1cc(C)c2c(n1)N(C)CCC2 |
| InChI | InChI=1S/C11H16N2.2C2H6/c1-8-7-9(2)12-11-10(8)5-4-6-13(11)3;2*1-2/h7H,4-6H2,1-3H3;2*1-2H3 |
| InChIKey | RPLHKAWELXKLCQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |