C11H12N2 — CID 171109634
6-ethynyl-1-methyl-3,4-dihydro-2H-1,8-naphthyridine (PubChem CID 171109634) has the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 6-ethynyl-1-methyl-3,4-dihydro-2H-1,8-naphthyridine.
| Compound Name | 6-ethynyl-1-methyl-3,4-dihydro-2H-1,8-naphthyridine |
|---|---|
| PubChem CID | 171109634 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 6-ethynyl-1-methyl-3,4-dihydro-2H-1,8-naphthyridine |
| SMILES | C#Cc1cnc2c(c1)CCCN2C |
| InChI | InChI=1S/C11H12N2/c1-3-9-7-10-5-4-6-13(2)11(10)12-8-9/h1,7-8H,4-6H2,2H3 |
| InChIKey | HPIQRELAOAOKTN-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|