C14H15N3 — CID 121385714
1-methyl-6-pyrimidin-5-yl-3,4-dihydro-2H-quinoline (PubChem CID 121385714) has the molecular formula C14H15N3 and a molecular weight of 225.30 g/mol. Its IUPAC name is 1-methyl-6-pyrimidin-5-yl-3,4-dihydro-2H-quinoline.
| Compound Name | 1-methyl-6-pyrimidin-5-yl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 121385714 |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 1-methyl-6-pyrimidin-5-yl-3,4-dihydro-2H-quinoline |
| SMILES | CN1CCCc2cc(-c3cncnc3)ccc21 |
| InChI | InChI=1S/C14H15N3/c1-17-6-2-3-12-7-11(4-5-14(12)17)13-8-15-10-16-9-13/h4-5,7-10H,2-3,6H2,1H3 |
| InChIKey | KMXBOEUIAAJSLA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |