About 6-(6-ethoxy-3-pyridinyl)-1-methyl-3,4-dihydro-2H-quinoline;octane
6-(6-ethoxy-3-pyridinyl)-1-methyl-3,4-dihydro-2H-quinoline;octane (PubChem CID 145105898) has the molecular formula C25H38N2O
and a molecular weight of 382.59 g/mol. Its IUPAC name is 6-(6-ethoxy-3-pyridinyl)-1-methyl-3,4-dihydro-2H-quinoline;octane.
Molecular Properties
| Compound Name | 6-(6-ethoxy-3-pyridinyl)-1-methyl-3,4-dihydro-2H-quinoline;octane |
| PubChem CID | 145105898 |
| Molecular Formula | C25H38N2O |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.30 |
| IUPAC Name | 6-(6-ethoxy-3-pyridinyl)-1-methyl-3,4-dihydro-2H-quinoline;octane |
| SMILES | CCCCCCCC.CCOc1ccc(-c2ccc3c(c2)CCCN3C)cn1 |
| InChI | InChI=1S/C17H20N2O.C8H18/c1-3-20-17-9-7-15(12-18-17)13-6-8-16-14(11-13)5-4-10-19(16)2;1-3-5-7-8-6-4-2/h6-9,11-12H,3-5,10H2,1-2H3;3-8H2,1-2H3 |
| InChIKey | HCLXHBGYOSWYGU-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(6-ethoxy-3-pyridinyl)-1-methyl-3,4-dihydro-2H-quinoline;octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(6-ethoxy-3-pyridinyl)-1-methyl-3,4-dihydro-2H-quinoline;octane?
The IUPAC name of 6-(6-ethoxy-3-pyridinyl)-1-methyl-3,4-dihydro-2H-quinoline;octane (CID 145105898) is 6-(6-ethoxy-3-pyridinyl)-1-methyl-3,4-dihydro-2H-quinoline;octane.
What is the SMILES notation for 6-(6-ethoxy-3-pyridinyl)-1-methyl-3,4-dihydro-2H-quinoline;octane?
The canonical SMILES for 6-(6-ethoxy-3-pyridinyl)-1-methyl-3,4-dihydro-2H-quinoline;octane is CCCCCCCC.CCOc1ccc(-c2ccc3c(c2)CCCN3C)cn1.
What is the InChIKey of 6-(6-ethoxy-3-pyridinyl)-1-methyl-3,4-dihydro-2H-quinoline;octane?
The InChIKey is HCLXHBGYOSWYGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O.C8H18/c1-3-20-17-9-7-15(12-18-17)13-6-8-16-14(11-13)5-4-10-19(16)2;1-3-5-7-8-6-4-2/h6-9,11-12H,3-5,10H2,1-2H3;3-8H2,1-2H3.
What are the key properties of 6-(6-ethoxy-3-pyridinyl)-1-methyl-3,4-dihydro-2H-quinoline;octane?
6-(6-ethoxy-3-pyridinyl)-1-methyl-3,4-dihydro-2H-quinoline;octane has a molecular weight of 382.59 g/mol, XLogP of 6.90, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(6-ethoxy-3-pyridinyl)-1-methyl-3,4-dihydro-2H-quinoline;octane is sourced from PubChem (CID 145105898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).