About hexane;1-methyl-6-(6-methyl-3-pyridinyl)-3,4-dihydro-2H-quinoline
hexane;1-methyl-6-(6-methyl-3-pyridinyl)-3,4-dihydro-2H-quinoline (PubChem CID 145091188) has the molecular formula C22H32N2
and a molecular weight of 324.51 g/mol. Its IUPAC name is hexane;1-methyl-6-(6-methyl-3-pyridinyl)-3,4-dihydro-2H-quinoline.
Molecular Properties
| Compound Name | hexane;1-methyl-6-(6-methyl-3-pyridinyl)-3,4-dihydro-2H-quinoline |
| PubChem CID | 145091188 |
| Molecular Formula | C22H32N2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.26 |
| IUPAC Name | hexane;1-methyl-6-(6-methyl-3-pyridinyl)-3,4-dihydro-2H-quinoline |
| SMILES | CCCCCC.Cc1ccc(-c2ccc3c(c2)CCCN3C)cn1 |
| InChI | InChI=1S/C16H18N2.C6H14/c1-12-5-6-15(11-17-12)13-7-8-16-14(10-13)4-3-9-18(16)2;1-3-5-6-4-2/h5-8,10-11H,3-4,9H2,1-2H3;3-6H2,1-2H3 |
| InChIKey | BYLTZEBTJIYYEN-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexane;1-methyl-6-(6-methyl-3-pyridinyl)-3,4-dihydro-2H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexane;1-methyl-6-(6-methyl-3-pyridinyl)-3,4-dihydro-2H-quinoline?
The IUPAC name of hexane;1-methyl-6-(6-methyl-3-pyridinyl)-3,4-dihydro-2H-quinoline (CID 145091188) is hexane;1-methyl-6-(6-methyl-3-pyridinyl)-3,4-dihydro-2H-quinoline.
What is the SMILES notation for hexane;1-methyl-6-(6-methyl-3-pyridinyl)-3,4-dihydro-2H-quinoline?
The canonical SMILES for hexane;1-methyl-6-(6-methyl-3-pyridinyl)-3,4-dihydro-2H-quinoline is CCCCCC.Cc1ccc(-c2ccc3c(c2)CCCN3C)cn1.
What is the InChIKey of hexane;1-methyl-6-(6-methyl-3-pyridinyl)-3,4-dihydro-2H-quinoline?
The InChIKey is BYLTZEBTJIYYEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2.C6H14/c1-12-5-6-15(11-17-12)13-7-8-16-14(10-13)4-3-9-18(16)2;1-3-5-6-4-2/h5-8,10-11H,3-4,9H2,1-2H3;3-6H2,1-2H3.
What are the key properties of hexane;1-methyl-6-(6-methyl-3-pyridinyl)-3,4-dihydro-2H-quinoline?
hexane;1-methyl-6-(6-methyl-3-pyridinyl)-3,4-dihydro-2H-quinoline has a molecular weight of 324.51 g/mol, XLogP of 6.03, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexane;1-methyl-6-(6-methyl-3-pyridinyl)-3,4-dihydro-2H-quinoline is sourced from PubChem (CID 145091188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).