C21H32N2S — CID 145091245
2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1,3-thiazole;octane (PubChem CID 145091245) has the molecular formula C21H32N2S and a molecular weight of 344.57 g/mol. Its IUPAC name is 2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1,3-thiazole;octane.
| Compound Name | 2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1,3-thiazole;octane |
|---|---|
| PubChem CID | 145091245 |
| Molecular Formula | C21H32N2S |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | 2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1,3-thiazole;octane |
| SMILES | CCCCCCCC.CN1CCCc2cc(-c3nccs3)ccc21 |
| InChI | InChI=1S/C13H14N2S.C8H18/c1-15-7-2-3-10-9-11(4-5-12(10)15)13-14-6-8-16-13;1-3-5-7-8-6-4-2/h4-6,8-9H,2-3,7H2,1H3;3-8H2,1-2H3 |
| InChIKey | QBEPCYBAPMJYKZ-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|