About hexane;1-methyl-5-(1-methylpyrazol-4-yl)-2,3-dihydroindole
hexane;1-methyl-5-(1-methylpyrazol-4-yl)-2,3-dihydroindole (PubChem CID 145091683) has the molecular formula C19H29N3
and a molecular weight of 299.46 g/mol. Its IUPAC name is hexane;1-methyl-5-(1-methylpyrazol-4-yl)-2,3-dihydroindole.
Molecular Properties
| Compound Name | hexane;1-methyl-5-(1-methylpyrazol-4-yl)-2,3-dihydroindole |
| PubChem CID | 145091683 |
| Molecular Formula | C19H29N3 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.24 |
| IUPAC Name | hexane;1-methyl-5-(1-methylpyrazol-4-yl)-2,3-dihydroindole |
| SMILES | CCCCCC.CN1CCc2cc(-c3cnn(C)c3)ccc21 |
| InChI | InChI=1S/C13H15N3.C6H14/c1-15-6-5-11-7-10(3-4-13(11)15)12-8-14-16(2)9-12;1-3-5-6-4-2/h3-4,7-9H,5-6H2,1-2H3;3-6H2,1-2H3 |
| InChIKey | VGRQMZINKZXDOQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexane;1-methyl-5-(1-methylpyrazol-4-yl)-2,3-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexane;1-methyl-5-(1-methylpyrazol-4-yl)-2,3-dihydroindole?
The IUPAC name of hexane;1-methyl-5-(1-methylpyrazol-4-yl)-2,3-dihydroindole (CID 145091683) is hexane;1-methyl-5-(1-methylpyrazol-4-yl)-2,3-dihydroindole.
What is the SMILES notation for hexane;1-methyl-5-(1-methylpyrazol-4-yl)-2,3-dihydroindole?
The canonical SMILES for hexane;1-methyl-5-(1-methylpyrazol-4-yl)-2,3-dihydroindole is CCCCCC.CN1CCc2cc(-c3cnn(C)c3)ccc21.
What is the InChIKey of hexane;1-methyl-5-(1-methylpyrazol-4-yl)-2,3-dihydroindole?
The InChIKey is VGRQMZINKZXDOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3.C6H14/c1-15-6-5-11-7-10(3-4-13(11)15)12-8-14-16(2)9-12;1-3-5-6-4-2/h3-4,7-9H,5-6H2,1-2H3;3-6H2,1-2H3.
What are the key properties of hexane;1-methyl-5-(1-methylpyrazol-4-yl)-2,3-dihydroindole?
hexane;1-methyl-5-(1-methylpyrazol-4-yl)-2,3-dihydroindole has a molecular weight of 299.46 g/mol, XLogP of 4.67, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hexane;1-methyl-5-(1-methylpyrazol-4-yl)-2,3-dihydroindole is sourced from PubChem (CID 145091683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).