C12H14N4 — CID 176983699
5-(1-methylpyrazol-4-yl)-2,3-dihydroindol-1-amine (PubChem CID 176983699) has the molecular formula C12H14N4 and a molecular weight of 214.27 g/mol. Its IUPAC name is 5-(1-methylpyrazol-4-yl)-2,3-dihydroindol-1-amine.
| Compound Name | 5-(1-methylpyrazol-4-yl)-2,3-dihydroindol-1-amine |
|---|---|
| PubChem CID | 176983699 |
| Molecular Formula | C12H14N4 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 5-(1-methylpyrazol-4-yl)-2,3-dihydroindol-1-amine |
| SMILES | Cn1cc(-c2ccc3c(c2)CCN3N)cn1 |
| InChI | InChI=1S/C12H14N4/c1-15-8-11(7-14-15)9-2-3-12-10(6-9)4-5-16(12)13/h2-3,6-8H,4-5,13H2,1H3 |
| InChIKey | LIPNHWZRVBKCSY-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|