C10H12N4 — CID 118693272
4-(1-methylpyrazol-4-yl)benzene-1,2-diamine (PubChem CID 118693272) has the molecular formula C10H12N4 and a molecular weight of 188.23 g/mol. Its IUPAC name is 4-(1-methylpyrazol-4-yl)benzene-1,2-diamine.
| Compound Name | 4-(1-methylpyrazol-4-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 118693272 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 4-(1-methylpyrazol-4-yl)benzene-1,2-diamine |
| SMILES | Cn1cc(-c2ccc(N)c(N)c2)cn1 |
| InChI | InChI=1S/C10H12N4/c1-14-6-8(5-13-14)7-2-3-9(11)10(12)4-7/h2-6H,11-12H2,1H3 |
| InChIKey | GNVFQPOFUZRQOM-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|