C14H17N3 — CID 121365287
3,3-dimethyl-5-(1-methylpyrazol-4-yl)-1,2-dihydroindole (PubChem CID 121365287) has the molecular formula C14H17N3 and a molecular weight of 227.31 g/mol. Its IUPAC name is 3,3-dimethyl-5-(1-methylpyrazol-4-yl)-1,2-dihydroindole.
| Compound Name | 3,3-dimethyl-5-(1-methylpyrazol-4-yl)-1,2-dihydroindole |
|---|---|
| PubChem CID | 121365287 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 3,3-dimethyl-5-(1-methylpyrazol-4-yl)-1,2-dihydroindole |
| SMILES | Cn1cc(-c2ccc3c(c2)C(C)(C)CN3)cn1 |
| InChI | InChI=1S/C14H17N3/c1-14(2)9-15-13-5-4-10(6-12(13)14)11-7-16-17(3)8-11/h4-8,15H,9H2,1-3H3 |
| InChIKey | GPIXMQANIINTTQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |