C12H10IN3 — CID 157423852
3-iodo-5-(1-methylpyrazol-4-yl)-1H-isoindole (PubChem CID 157423852) has the molecular formula C12H10IN3 and a molecular weight of 323.14 g/mol. Its IUPAC name is 3-iodo-5-(1-methylpyrazol-4-yl)-1H-isoindole.
| Compound Name | 3-iodo-5-(1-methylpyrazol-4-yl)-1H-isoindole |
|---|---|
| PubChem CID | 157423852 |
| Molecular Formula | C12H10IN3 |
| Molecular Weight | 323.14 g/mol |
| Exact Mass | 322.99 |
| IUPAC Name | 3-iodo-5-(1-methylpyrazol-4-yl)-1H-isoindole |
| SMILES | Cn1cc(-c2ccc3c(c2)C(I)=NC3)cn1 |
| InChI | InChI=1S/C12H10IN3/c1-16-7-10(6-15-16)8-2-3-9-5-14-12(13)11(9)4-8/h2-4,6-7H,5H2,1H3 |
| InChIKey | NHTRDJLVTPMTAH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.14 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|