C10H12N4O — CID 106748568
4-(1-methylpyrazol-4-yl)oxybenzene-1,2-diamine (PubChem CID 106748568) has the molecular formula C10H12N4O and a molecular weight of 204.23 g/mol. Its IUPAC name is 4-(1-methylpyrazol-4-yl)oxybenzene-1,2-diamine.
| Compound Name | 4-(1-methylpyrazol-4-yl)oxybenzene-1,2-diamine |
|---|---|
| PubChem CID | 106748568 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 4-(1-methylpyrazol-4-yl)oxybenzene-1,2-diamine |
| SMILES | Cn1cc(Oc2ccc(N)c(N)c2)cn1 |
| InChI | InChI=1S/C10H12N4O/c1-14-6-8(5-13-14)15-7-2-3-9(11)10(12)4-7/h2-6H,11-12H2,1H3 |
| InChIKey | IGGYNRGEFAKFSS-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|