C16H17N3 — CID 139398485
(3R)-3-ethynyl-1-methyl-6-(1-methylpyrazol-4-yl)-3,4-dihydro-2H-quinoline (PubChem CID 139398485) has the molecular formula C16H17N3 and a molecular weight of 251.33 g/mol. Its IUPAC name is (3R)-3-ethynyl-1-methyl-6-(1-methylpyrazol-4-yl)-3,4-dihydro-2H-quinoline.
| Compound Name | (3R)-3-ethynyl-1-methyl-6-(1-methylpyrazol-4-yl)-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 139398485 |
| Molecular Formula | C16H17N3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | (3R)-3-ethynyl-1-methyl-6-(1-methylpyrazol-4-yl)-3,4-dihydro-2H-quinoline |
| SMILES | C#C[C@H]1Cc2cc(-c3cnn(C)c3)ccc2N(C)C1 |
| InChI | InChI=1S/C16H17N3/c1-4-12-7-14-8-13(15-9-17-19(3)11-15)5-6-16(14)18(2)10-12/h1,5-6,8-9,11-12H,7,10H2,2-3H3/t12-/m0/s1 |
| InChIKey | DMVHFFNNZCMKBI-LBPRGKRZSA-N |
| XLogP | 2.33 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|