C22H35N3 — CID 145105875
1,3-dimethyl-6-(1-methylpyrazol-4-yl)-3,4-dihydro-2H-quinoline;heptane (PubChem CID 145105875) has the molecular formula C22H35N3 and a molecular weight of 341.54 g/mol. Its IUPAC name is 1,3-dimethyl-6-(1-methylpyrazol-4-yl)-3,4-dihydro-2H-quinoline;heptane.
| Compound Name | 1,3-dimethyl-6-(1-methylpyrazol-4-yl)-3,4-dihydro-2H-quinoline;heptane |
|---|---|
| PubChem CID | 145105875 |
| Molecular Formula | C22H35N3 |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.28 |
| IUPAC Name | 1,3-dimethyl-6-(1-methylpyrazol-4-yl)-3,4-dihydro-2H-quinoline;heptane |
| SMILES | CC1Cc2cc(-c3cnn(C)c3)ccc2N(C)C1.CCCCCCC |
| InChI | InChI=1S/C15H19N3.C7H16/c1-11-6-13-7-12(14-8-16-18(3)10-14)4-5-15(13)17(2)9-11;1-3-5-7-6-4-2/h4-5,7-8,10-11H,6,9H2,1-3H3;3-7H2,1-2H3 |
| InChIKey | AFOAJTCJOQCNLZ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|