About 6-fluoro-1,3-dimethyl-3,4-dihydro-2H-quinoline
6-fluoro-1,3-dimethyl-3,4-dihydro-2H-quinoline (PubChem CID 139326271) has the molecular formula C11H14FN
and a molecular weight of 179.24 g/mol. Its IUPAC name is 6-fluoro-1,3-dimethyl-3,4-dihydro-2H-quinoline.
Molecular Properties
| Compound Name | 6-fluoro-1,3-dimethyl-3,4-dihydro-2H-quinoline |
| PubChem CID | 139326271 |
| Molecular Formula | C11H14FN |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 6-fluoro-1,3-dimethyl-3,4-dihydro-2H-quinoline |
| SMILES | CC1Cc2cc(F)ccc2N(C)C1 |
| InChI | InChI=1S/C11H14FN/c1-8-5-9-6-10(12)3-4-11(9)13(2)7-8/h3-4,6,8H,5,7H2,1-2H3 |
| InChIKey | LHOKWTGQNZCXIA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-fluoro-1,3-dimethyl-3,4-dihydro-2H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-1,3-dimethyl-3,4-dihydro-2H-quinoline?
The IUPAC name of 6-fluoro-1,3-dimethyl-3,4-dihydro-2H-quinoline (CID 139326271) is 6-fluoro-1,3-dimethyl-3,4-dihydro-2H-quinoline.
What is the SMILES notation for 6-fluoro-1,3-dimethyl-3,4-dihydro-2H-quinoline?
The canonical SMILES for 6-fluoro-1,3-dimethyl-3,4-dihydro-2H-quinoline is CC1Cc2cc(F)ccc2N(C)C1.
What is the InChIKey of 6-fluoro-1,3-dimethyl-3,4-dihydro-2H-quinoline?
The InChIKey is LHOKWTGQNZCXIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14FN/c1-8-5-9-6-10(12)3-4-11(9)13(2)7-8/h3-4,6,8H,5,7H2,1-2H3.
What are the key properties of 6-fluoro-1,3-dimethyl-3,4-dihydro-2H-quinoline?
6-fluoro-1,3-dimethyl-3,4-dihydro-2H-quinoline has a molecular weight of 179.24 g/mol, XLogP of 2.45, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-1,3-dimethyl-3,4-dihydro-2H-quinoline is sourced from PubChem (CID 139326271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).