C11H14FN — CID 139326271
6-fluoro-1,3-dimethyl-3,4-dihydro-2H-quinoline (PubChem CID 139326271) has the molecular formula C11H14FN and a molecular weight of 179.24 g/mol. Its IUPAC name is 6-fluoro-1,3-dimethyl-3,4-dihydro-2H-quinoline.
| Compound Name | 6-fluoro-1,3-dimethyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 139326271 |
| Molecular Formula | C11H14FN |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 6-fluoro-1,3-dimethyl-3,4-dihydro-2H-quinoline |
| SMILES | CC1Cc2cc(F)ccc2N(C)C1 |
| InChI | InChI=1S/C11H14FN/c1-8-5-9-6-10(12)3-4-11(9)13(2)7-8/h3-4,6,8H,5,7H2,1-2H3 |
| InChIKey | LHOKWTGQNZCXIA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |