C13H18N2O — CID 139326055
(3R)-N,1,3-trimethyl-3,4-dihydro-2H-quinoline-6-carboxamide (PubChem CID 139326055) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is (3R)-N,1,3-trimethyl-3,4-dihydro-2H-quinoline-6-carboxamide.
| Compound Name | (3R)-N,1,3-trimethyl-3,4-dihydro-2H-quinoline-6-carboxamide |
|---|---|
| PubChem CID | 139326055 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | (3R)-N,1,3-trimethyl-3,4-dihydro-2H-quinoline-6-carboxamide |
| SMILES | CNC(=O)c1ccc2c(c1)C[C@@H](C)CN2C |
| InChI | InChI=1S/C13H18N2O/c1-9-6-11-7-10(13(16)14-2)4-5-12(11)15(3)8-9/h4-5,7,9H,6,8H2,1-3H3,(H,14,16)/t9-/m1/s1 |
| InChIKey | KBPLOBKTVRQXDW-SECBINFHSA-N |
| XLogP | 1.67 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |