C12H15NO — CID 58663133
N,1-dimethyl-2,3-dihydro-1H-indene-5-carboxamide (PubChem CID 58663133) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is N,1-dimethyl-2,3-dihydro-1H-indene-5-carboxamide.
| Compound Name | N,1-dimethyl-2,3-dihydro-1H-indene-5-carboxamide |
|---|---|
| PubChem CID | 58663133 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | N,1-dimethyl-2,3-dihydro-1H-indene-5-carboxamide |
| SMILES | CNC(=O)c1ccc2c(c1)CCC2C |
| InChI | InChI=1S/C12H15NO/c1-8-3-4-9-7-10(12(14)13-2)5-6-11(8)9/h5-8H,3-4H2,1-2H3,(H,13,14) |
| InChIKey | USNFUGMLPTZCEY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |